Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Acrylamide, 98+%
CAS: 79-06-1 Molecular Formula: C3H5NO Molecular Weight (g/mol): 71.08 MDL Number: MFCD00008032 InChI Key: HRPVXLWXLXDGHG-UHFFFAOYSA-N Synonym: acrylamide,2-propenamide,propenamide,acrylic amide,akrylamid,ethylenecarboxamide,vinyl amide,acrylic acid amide,2-propeneamide,propeneamide PubChem CID: 6579 ChEBI: CHEBI:28619 IUPAC Name: prop-2-enamide SMILES: NC(=O)C=C
| PubChem CID | 6579 |
|---|---|
| CAS | 79-06-1 |
| Molecular Weight (g/mol) | 71.08 |
| ChEBI | CHEBI:28619 |
| MDL Number | MFCD00008032 |
| SMILES | NC(=O)C=C |
| Synonym | acrylamide,2-propenamide,propenamide,acrylic amide,akrylamid,ethylenecarboxamide,vinyl amide,acrylic acid amide,2-propeneamide,propeneamide |
| IUPAC Name | prop-2-enamide |
| InChI Key | HRPVXLWXLXDGHG-UHFFFAOYSA-N |
| Molecular Formula | C3H5NO |
Sebacoyl chloride, 92%, technical
CAS: 111-19-3 Molecular Formula: C10H16Cl2O2 Molecular Weight (g/mol): 239.14 MDL Number: MFCD00000770 InChI Key: WMPOZLHMGVKUEJ-UHFFFAOYSA-N Synonym: sebacoyl chloride,sebacyl chloride,sebacoyl dichloride,sebacic acid dichloride,decanedioyl chloride,sebacoylchloride,octane-1,8-dicarbonyl chloride,sebacoyl chloride, cp,acmc-1byrk,decanedioic acid chloride PubChem CID: 66072 IUPAC Name: decanedioyl dichloride SMILES: C(CCCCC(=O)Cl)CCCC(=O)Cl
| PubChem CID | 66072 |
|---|---|
| CAS | 111-19-3 |
| Molecular Weight (g/mol) | 239.14 |
| MDL Number | MFCD00000770 |
| SMILES | C(CCCCC(=O)Cl)CCCC(=O)Cl |
| Synonym | sebacoyl chloride,sebacyl chloride,sebacoyl dichloride,sebacic acid dichloride,decanedioyl chloride,sebacoylchloride,octane-1,8-dicarbonyl chloride,sebacoyl chloride, cp,acmc-1byrk,decanedioic acid chloride |
| IUPAC Name | decanedioyl dichloride |
| InChI Key | WMPOZLHMGVKUEJ-UHFFFAOYSA-N |
| Molecular Formula | C10H16Cl2O2 |
Carbon black, acetylene, 100% compressed
CAS: 1333-86-4 Molecular Formula: C Molecular Weight (g/mol): 12.01 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N
| CAS | 1333-86-4 |
|---|---|
| Molecular Weight (g/mol) | 12.01 |
| MDL Number | MFCD00133992 |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Melatonin, 99+%
CAS: 73-31-4 Molecular Formula: C13H16N2O2 Molecular Weight (g/mol): 232.283 MDL Number: MFCD00005655 InChI Key: DRLFMBDRBRZALE-UHFFFAOYSA-N Synonym: melatonin,melatonine,n-acetyl-5-methoxytryptamine,circadin,5-methoxy-n-acetyltryptamine,n-2-5-methoxy-1h-indol-3-yl ethyl acetamide,melatol,melatonex,melovine PubChem CID: 896 ChEBI: CHEBI:16796 IUPAC Name: N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide SMILES: CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC
| PubChem CID | 896 |
|---|---|
| CAS | 73-31-4 |
| Molecular Weight (g/mol) | 232.283 |
| ChEBI | CHEBI:16796 |
| MDL Number | MFCD00005655 |
| SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
| Synonym | melatonin,melatonine,n-acetyl-5-methoxytryptamine,circadin,5-methoxy-n-acetyltryptamine,n-2-5-methoxy-1h-indol-3-yl ethyl acetamide,melatol,melatonex,melovine |
| IUPAC Name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| InChI Key | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| Molecular Formula | C13H16N2O2 |
Riboflavin, 98%
CAS: 83-88-5 Molecular Formula: C17H20N4O6 Molecular Weight (g/mol): 376.37 MDL Number: MFCD00005022 InChI Key: AUNGANRZJHBGPY-QTZZOOGMNA-N Synonym: riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin PubChem CID: 71310809 IUPAC Name: 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione SMILES: CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1
| PubChem CID | 71310809 |
|---|---|
| CAS | 83-88-5 |
| Molecular Weight (g/mol) | 376.37 |
| MDL Number | MFCD00005022 |
| SMILES | CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1 |
| Synonym | riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin |
| IUPAC Name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione |
| InChI Key | AUNGANRZJHBGPY-QTZZOOGMNA-N |
| Molecular Formula | C17H20N4O6 |
Dichloroisocyanuric acid sodium salt, 97% (dry wt.)
CAS: 2893-78-9 Molecular Formula: C3HCl2N3NaO3 Molecular Weight (g/mol): 220.949 MDL Number: MFCD00006036 InChI Key: UNWRHVZXVVTASG-UHFFFAOYSA-N Synonym: sodium dichlorocyanuric acid,1,3,5-triazine-2,4,6 1h,3h,5h-trione, 1,3-dichloro-, sodium salt PubChem CID: 86657659 IUPAC Name: 1,3-dichloro-1,3,5-triazinane-2,4,6-trione;sodium SMILES: C1(=O)NC(=O)N(C(=O)N1Cl)Cl.[Na]
| PubChem CID | 86657659 |
|---|---|
| CAS | 2893-78-9 |
| Molecular Weight (g/mol) | 220.949 |
| MDL Number | MFCD00006036 |
| SMILES | C1(=O)NC(=O)N(C(=O)N1Cl)Cl.[Na] |
| Synonym | sodium dichlorocyanuric acid,1,3,5-triazine-2,4,6 1h,3h,5h-trione, 1,3-dichloro-, sodium salt |
| IUPAC Name | 1,3-dichloro-1,3,5-triazinane-2,4,6-trione;sodium |
| InChI Key | UNWRHVZXVVTASG-UHFFFAOYSA-N |
| Molecular Formula | C3HCl2N3NaO3 |
Tetrabutylammonium hydrogen sulfate, 99%, for HPLC
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 94433 |
|---|---|
| CAS | 32503-27-8 |
| Molecular Weight (g/mol) | 339.54 |
| MDL Number | MFCD00011637 |
| SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
| IUPAC Name | hydrogen sulfate;tetrabutylazanium |
| InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO4S |
4-Nitroaniline, 99%
CAS: 100-01-6 Molecular Formula: C6H6N2O2 Molecular Weight (g/mol): 138.13 MDL Number: MFCD00007858 InChI Key: TYMLOMAKGOJONV-UHFFFAOYSA-N Synonym: p-nitroaniline,p-nitraniline,4-nitrobenzenamine,p-aminonitrobenzene,4-nitraniline,benzenamine, 4-nitro,p-nitrophenylamine,1-amino-4-nitrobenzene,aniline, p-nitro,developer p PubChem CID: 7475 ChEBI: CHEBI:17064 IUPAC Name: 4-nitroaniline SMILES: NC1=CC=C(C=C1)[N+]([O-])=O
| PubChem CID | 7475 |
|---|---|
| CAS | 100-01-6 |
| Molecular Weight (g/mol) | 138.13 |
| ChEBI | CHEBI:17064 |
| MDL Number | MFCD00007858 |
| SMILES | NC1=CC=C(C=C1)[N+]([O-])=O |
| Synonym | p-nitroaniline,p-nitraniline,4-nitrobenzenamine,p-aminonitrobenzene,4-nitraniline,benzenamine, 4-nitro,p-nitrophenylamine,1-amino-4-nitrobenzene,aniline, p-nitro,developer p |
| IUPAC Name | 4-nitroaniline |
| InChI Key | TYMLOMAKGOJONV-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2O2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.154 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.154 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |
Sodium tert-butoxide, 99%, pure
CAS: 865-48-5 Molecular Formula: C4H9NaO Molecular Weight (g/mol): 96.1 MDL Number: MFCD00040575 InChI Key: MFRIHAYPQRLWNB-UHFFFAOYSA-N Synonym: sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide PubChem CID: 23676156 IUPAC Name: sodium;2-methylpropan-2-olate SMILES: CC(C)(C)[O-].[Na+]
| PubChem CID | 23676156 |
|---|---|
| CAS | 865-48-5 |
| Molecular Weight (g/mol) | 96.1 |
| MDL Number | MFCD00040575 |
| SMILES | CC(C)(C)[O-].[Na+] |
| Synonym | sodium tert-butoxide,sodium 2-methylpropan-2-olate,sodium t-butoxide,sodium-t-butoxide,t-butoxy sodium,tert-butoxysodium,naotbu,tbuona,2-propanol, 2-methyl-, sodium salt,sodium-tert-butoxide |
| IUPAC Name | sodium;2-methylpropan-2-olate |
| InChI Key | MFRIHAYPQRLWNB-UHFFFAOYSA-N |
| Molecular Formula | C4H9NaO |
Poly(ethylene glycol), average M.W. 1500
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Dioctyl sulfosuccinate sodium salt, 96%
CAS: 577-11-7 Molecular Formula: C20H37NaO7S Molecular Weight (g/mol): 444.56 MDL Number: MFCD00012455 InChI Key: APSBXTVYXVQYAB-UHFFFAOYNA-M Synonym: docusate sodium,dioctyl sodium sulfosuccinate,aerosol ot,constonate,diox,manoxol ot,diomedicone,clestol,complemix,defilin PubChem CID: 23673837 IUPAC Name: sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate SMILES: [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O
| PubChem CID | 23673837 |
|---|---|
| CAS | 577-11-7 |
| Molecular Weight (g/mol) | 444.56 |
| MDL Number | MFCD00012455 |
| SMILES | [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O |
| Synonym | docusate sodium,dioctyl sodium sulfosuccinate,aerosol ot,constonate,diox,manoxol ot,diomedicone,clestol,complemix,defilin |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
| InChI Key | APSBXTVYXVQYAB-UHFFFAOYNA-M |
| Molecular Formula | C20H37NaO7S |
Hydroxypropyl-beta-cyclodextrin, 97%
CAS: 128446-35-5 Molecular Formula: C44H75O36 Molecular Weight (g/mol): 1180.05 MDL Number: MFCD16621721
| CAS | 128446-35-5 |
|---|---|
| Molecular Weight (g/mol) | 1180.05 |
| MDL Number | MFCD16621721 |
| Molecular Formula | C44H75O36 |
| CAS | 8008-74-0 |
|---|---|
| MDL Number | MFCD00132243 |
2,4-Pentanedione, 99%
CAS: 123-54-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008787 InChI Key: YRKCREAYFQTBPV-UHFFFAOYSA-N Synonym: 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone PubChem CID: 31261 ChEBI: CHEBI:14750 IUPAC Name: pentane-2,4-dione SMILES: CC(=O)CC(C)=O
| PubChem CID | 31261 |
|---|---|
| CAS | 123-54-6 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:14750 |
| MDL Number | MFCD00008787 |
| SMILES | CC(=O)CC(C)=O |
| Synonym | 2,4-pentanedione,acetylacetone,2,4-pentadione,diacetylmethane,acetoacetone,acac,2,4-dioxopentane,pentanedione,pentan-2,4-dione,acetyl acetone |
| IUPAC Name | pentane-2,4-dione |
| InChI Key | YRKCREAYFQTBPV-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |